C24H27N5O2 — CID 135947386
2-(4-aminophenyl)-6-[(2-cyclopentyloxy-3-pyridinyl)methyl]-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one (PubChem CID 135947386) has the molecular formula C24H27N5O2 and a molecular weight of 417.51 g/mol. Its IUPAC name is 2-(4-aminophenyl)-6-[(2-cyclopentyloxy-3-pyridinyl)methyl]-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one.
| Compound Name | 2-(4-aminophenyl)-6-[(2-cyclopentyloxy-3-pyridinyl)methyl]-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 135947386 |
| Molecular Formula | C24H27N5O2 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.22 |
| IUPAC Name | 2-(4-aminophenyl)-6-[(2-cyclopentyloxy-3-pyridinyl)methyl]-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
| SMILES | Nc1ccc(-c2nc3c(c(=O)[nH]2)CN(Cc2cccnc2OC2CCCC2)CC3)cc1 |
| InChI | InChI=1S/C24H27N5O2/c25-18-9-7-16(8-10-18)22-27-21-11-13-29(15-20(21)23(30)28-22)14-17-4-3-12-26-24(17)31-19-5-1-2-6-19/h3-4,7-10,12,19H,1-2,5-6,11,13-15,25H2,(H,27,28,30) |
| InChIKey | JMFSGFFJJBVGDJ-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 97.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|