C14H15BrN4O3S — CID 135946109
6-[(2-bromo-3-pyridinyl)methyl]-2-methylsulfonyl-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one (PubChem CID 135946109) has the molecular formula C14H15BrN4O3S and a molecular weight of 399.27 g/mol. Its IUPAC name is 6-[(2-bromo-3-pyridinyl)methyl]-2-methylsulfonyl-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one.
| Compound Name | 6-[(2-bromo-3-pyridinyl)methyl]-2-methylsulfonyl-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 135946109 |
| Molecular Formula | C14H15BrN4O3S |
| Molecular Weight | 399.27 g/mol |
| Exact Mass | 398.00 |
| IUPAC Name | 6-[(2-bromo-3-pyridinyl)methyl]-2-methylsulfonyl-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
| SMILES | CS(=O)(=O)c1nc2c(c(=O)[nH]1)CN(Cc1cccnc1Br)CC2 |
| InChI | InChI=1S/C14H15BrN4O3S/c1-23(21,22)14-17-11-4-6-19(8-10(11)13(20)18-14)7-9-3-2-5-16-12(9)15/h2-3,5H,4,6-8H2,1H3,(H,17,18,20) |
| InChIKey | DYQCCCOQGBNYFR-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.27 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|