C21H21N7O — CID 135945013
2-(4-aminophenyl)-6-[(2-methylimidazo[1,2-a]pyrimidin-3-yl)methyl]-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one (PubChem CID 135945013) has the molecular formula C21H21N7O and a molecular weight of 387.45 g/mol. Its IUPAC name is 2-(4-aminophenyl)-6-[(2-methylimidazo[1,2-a]pyrimidin-3-yl)methyl]-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one.
| Compound Name | 2-(4-aminophenyl)-6-[(2-methylimidazo[1,2-a]pyrimidin-3-yl)methyl]-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 135945013 |
| Molecular Formula | C21H21N7O |
| Molecular Weight | 387.45 g/mol |
| Exact Mass | 387.18 |
| IUPAC Name | 2-(4-aminophenyl)-6-[(2-methylimidazo[1,2-a]pyrimidin-3-yl)methyl]-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
| SMILES | Cc1nc2ncccn2c1CN1CCc2nc(-c3ccc(N)cc3)[nH]c(=O)c2C1 |
| InChI | InChI=1S/C21H21N7O/c1-13-18(28-9-2-8-23-21(28)24-13)12-27-10-7-17-16(11-27)20(29)26-19(25-17)14-3-5-15(22)6-4-14/h2-6,8-9H,7,10-12,22H2,1H3,(H,25,26,29) |
| InChIKey | CDFADYSEZZOTSA-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 105.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.45 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|