C26H27N5O — CID 135861745
2-(4-aminophenyl)-6-[(2,5-dimethyl-1-phenylpyrrol-3-yl)methyl]-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one (PubChem CID 135861745) has the molecular formula C26H27N5O and a molecular weight of 425.54 g/mol. Its IUPAC name is 2-(4-aminophenyl)-6-[(2,5-dimethyl-1-phenylpyrrol-3-yl)methyl]-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one.
| Compound Name | 2-(4-aminophenyl)-6-[(2,5-dimethyl-1-phenylpyrrol-3-yl)methyl]-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 135861745 |
| Molecular Formula | C26H27N5O |
| Molecular Weight | 425.54 g/mol |
| Exact Mass | 425.22 |
| IUPAC Name | 2-(4-aminophenyl)-6-[(2,5-dimethyl-1-phenylpyrrol-3-yl)methyl]-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
| SMILES | Cc1cc(CN2CCc3nc(-c4ccc(N)cc4)[nH]c(=O)c3C2)c(C)n1-c1ccccc1 |
| InChI | InChI=1S/C26H27N5O/c1-17-14-20(18(2)31(17)22-6-4-3-5-7-22)15-30-13-12-24-23(16-30)26(32)29-25(28-24)19-8-10-21(27)11-9-19/h3-11,14H,12-13,15-16,27H2,1-2H3,(H,28,29,32) |
| InChIKey | SIKKKMMJEUDQOV-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 79.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.54 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|