C19H17N5O4 — CID 135919091
6-[(3-hydroxy-4-nitrophenyl)methyl]-2-pyridin-4-yl-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one (PubChem CID 135919091) has the molecular formula C19H17N5O4 and a molecular weight of 379.38 g/mol. Its IUPAC name is 6-[(3-hydroxy-4-nitrophenyl)methyl]-2-pyridin-4-yl-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one.
| Compound Name | 6-[(3-hydroxy-4-nitrophenyl)methyl]-2-pyridin-4-yl-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 135919091 |
| Molecular Formula | C19H17N5O4 |
| Molecular Weight | 379.38 g/mol |
| Exact Mass | 379.13 |
| IUPAC Name | 6-[(3-hydroxy-4-nitrophenyl)methyl]-2-pyridin-4-yl-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
| SMILES | O=c1[nH]c(-c2ccncc2)nc2c1CN(Cc1ccc([N+](=O)[O-])c(O)c1)CC2 |
| InChI | InChI=1S/C19H17N5O4/c25-17-9-12(1-2-16(17)24(27)28)10-23-8-5-15-14(11-23)19(26)22-18(21-15)13-3-6-20-7-4-13/h1-4,6-7,9,25H,5,8,10-11H2,(H,21,22,26) |
| InChIKey | VVNCVKAKKSSBHU-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 125.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.38 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|