C19H18N4O3S — CID 135920018
6-[(4-methyl-3-nitrophenyl)methyl]-2-thiophen-2-yl-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one (PubChem CID 135920018) has the molecular formula C19H18N4O3S and a molecular weight of 382.45 g/mol. Its IUPAC name is 6-[(4-methyl-3-nitrophenyl)methyl]-2-thiophen-2-yl-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one.
| Compound Name | 6-[(4-methyl-3-nitrophenyl)methyl]-2-thiophen-2-yl-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 135920018 |
| Molecular Formula | C19H18N4O3S |
| Molecular Weight | 382.45 g/mol |
| Exact Mass | 382.11 |
| IUPAC Name | 6-[(4-methyl-3-nitrophenyl)methyl]-2-thiophen-2-yl-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
| SMILES | Cc1ccc(CN2CCc3nc(-c4cccs4)[nH]c(=O)c3C2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H18N4O3S/c1-12-4-5-13(9-16(12)23(25)26)10-22-7-6-15-14(11-22)19(24)21-18(20-15)17-3-2-8-27-17/h2-5,8-9H,6-7,10-11H2,1H3,(H,20,21,24) |
| InChIKey | QFPLYFGOVWNLDS-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 92.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.45 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|