C18H20N4OS — CID 135925861
3-[4-[[(2R)-oxolan-2-yl]methyl]-5-prop-2-enylsulfanyl-1,2,4-triazol-3-yl]-1H-indole (PubChem CID 135925861) has the molecular formula C18H20N4OS and a molecular weight of 340.45 g/mol. Its IUPAC name is 3-[4-[[(2R)-oxolan-2-yl]methyl]-5-prop-2-enylsulfanyl-1,2,4-triazol-3-yl]-1H-indole.
| Compound Name | 3-[4-[[(2R)-oxolan-2-yl]methyl]-5-prop-2-enylsulfanyl-1,2,4-triazol-3-yl]-1H-indole |
|---|---|
| PubChem CID | 135925861 |
| Molecular Formula | C18H20N4OS |
| Molecular Weight | 340.45 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | 3-[4-[[(2R)-oxolan-2-yl]methyl]-5-prop-2-enylsulfanyl-1,2,4-triazol-3-yl]-1H-indole |
| SMILES | C=CCSc1nnc(-c2c[nH]c3ccccc23)n1C[C@H]1CCCO1 |
| InChI | InChI=1S/C18H20N4OS/c1-2-10-24-18-21-20-17(22(18)12-13-6-5-9-23-13)15-11-19-16-8-4-3-7-14(15)16/h2-4,7-8,11,13,19H,1,5-6,9-10,12H2/t13-/m1/s1 |
| InChIKey | VAIWRJIRKHDWQH-CYBMUJFWSA-N |
| XLogP | 3.88 |
| TPSA | 55.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.45 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|