C17H23FN5O6P — CID 135927188
9-[(2R,4aR,6R,7R,7aR)-2-cyclohexyloxy-7-fluoro-7-methyl-2-oxo-4,4a,6,7a-tetrahydrofuro[3,2-d][1,3,2]dioxaphosphinin-6-yl]-2-amino-1H-purin-6-one (PubChem CID 135927188) has the molecular formula C17H23FN5O6P and a molecular weight of 443.37 g/mol. Its IUPAC name is 9-[(2R,4aR,6R,7R,7aR)-2-cyclohexyloxy-7-fluoro-7-methyl-2-oxo-4,4a,6,7a-tetrahydrofuro[3,2-d][1,3,2]dioxaphosphinin-6-yl]-2-amino-1H-purin-6-one.
| Compound Name | 9-[(2R,4aR,6R,7R,7aR)-2-cyclohexyloxy-7-fluoro-7-methyl-2-oxo-4,4a,6,7a-tetrahydrofuro[3,2-d][1,3,2]dioxaphosphinin-6-yl]-2-amino-1H-purin-6-one |
|---|---|
| PubChem CID | 135927188 |
| Molecular Formula | C17H23FN5O6P |
| Molecular Weight | 443.37 g/mol |
| Exact Mass | 443.14 |
| IUPAC Name | 9-[(2R,4aR,6R,7R,7aR)-2-cyclohexyloxy-7-fluoro-7-methyl-2-oxo-4,4a,6,7a-tetrahydrofuro[3,2-d][1,3,2]dioxaphosphinin-6-yl]-2-amino-1H-purin-6-one |
| SMILES | C[C@@]1(F)[C@@H]2O[P@@](=O)(OC3CCCCC3)OC[C@H]2O[C@H]1n1cnc2c(=O)[nH]c(N)nc21 |
| InChI | InChI=1S/C17H23FN5O6P/c1-17(18)12-10(7-26-30(25,29-12)28-9-5-3-2-4-6-9)27-15(17)23-8-20-11-13(23)21-16(19)22-14(11)24/h8-10,12,15H,2-7H2,1H3,(H3,19,21,22,24)/t10-,12-,15-,17-,30-/m1/s1 |
| InChIKey | AUKSWSYKLHIOJG-QOOYFGEHSA-N |
| XLogP | 2.20 |
| TPSA | 143.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.37 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|