C14H17FN5O6P — CID 144683674
2-amino-9-[(2R,6R)-7-fluoro-7-methyl-2-oxo-2-propan-2-yloxy-4,6-dihydrofuro[3,2-d][1,3,2]dioxaphosphinin-6-yl]-1H-purin-6-one (PubChem CID 144683674) has the molecular formula C14H17FN5O6P and a molecular weight of 401.29 g/mol. Its IUPAC name is 2-amino-9-[(2R,6R)-7-fluoro-7-methyl-2-oxo-2-propan-2-yloxy-4,6-dihydrofuro[3,2-d][1,3,2]dioxaphosphinin-6-yl]-1H-purin-6-one.
| Compound Name | 2-amino-9-[(2R,6R)-7-fluoro-7-methyl-2-oxo-2-propan-2-yloxy-4,6-dihydrofuro[3,2-d][1,3,2]dioxaphosphinin-6-yl]-1H-purin-6-one |
|---|---|
| PubChem CID | 144683674 |
| Molecular Formula | C14H17FN5O6P |
| Molecular Weight | 401.29 g/mol |
| Exact Mass | 401.09 |
| IUPAC Name | 2-amino-9-[(2R,6R)-7-fluoro-7-methyl-2-oxo-2-propan-2-yloxy-4,6-dihydrofuro[3,2-d][1,3,2]dioxaphosphinin-6-yl]-1H-purin-6-one |
| SMILES | CC(C)O[P@@]1(=O)OCC2=C(O1)C(C)(F)[C@H](n1cnc3c(=O)[nH]c(N)nc31)O2 |
| InChI | InChI=1S/C14H17FN5O6P/c1-6(2)25-27(22)23-4-7-9(26-27)14(3,15)12(24-7)20-5-17-8-10(20)18-13(16)19-11(8)21/h5-6,12H,4H2,1-3H3,(H3,16,18,19,21)/t12-,14?,27-/m1/s1 |
| InChIKey | CEVZWVXFIVWBII-KFKVMGHPSA-N |
| XLogP | 1.75 |
| TPSA | 143.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.29 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|