C19H15N3O2 — CID 135927408
3-hydroxy-4-[(E)-indol-3-ylidenemethyl]-2-(4-methylphenyl)-1H-pyrazol-5-one (PubChem CID 135927408) has the molecular formula C19H15N3O2 and a molecular weight of 317.35 g/mol. Its IUPAC name is 3-hydroxy-4-[(E)-indol-3-ylidenemethyl]-2-(4-methylphenyl)-1H-pyrazol-5-one.
| Compound Name | 3-hydroxy-4-[(E)-indol-3-ylidenemethyl]-2-(4-methylphenyl)-1H-pyrazol-5-one |
|---|---|
| PubChem CID | 135927408 |
| Molecular Formula | C19H15N3O2 |
| Molecular Weight | 317.35 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | 3-hydroxy-4-[(E)-indol-3-ylidenemethyl]-2-(4-methylphenyl)-1H-pyrazol-5-one |
| SMILES | Cc1ccc(-n2[nH]c(=O)c(/C=C3/C=Nc4ccccc43)c2O)cc1 |
| InChI | InChI=1S/C19H15N3O2/c1-12-6-8-14(9-7-12)22-19(24)16(18(23)21-22)10-13-11-20-17-5-3-2-4-15(13)17/h2-11,24H,1H3,(H,21,23)/b13-10- |
| InChIKey | UYOYVJGCMKBTRQ-RAXLEYEMSA-N |
| XLogP | 3.44 |
| TPSA | 70.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.35 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |