C19H15N3O4S — CID 18339050
4-[4-[(E)-indol-3-ylidenemethyl]-5-methyl-3-oxo-1H-pyrazol-2-yl]benzenesulfonic acid (PubChem CID 18339050) has the molecular formula C19H15N3O4S and a molecular weight of 381.41 g/mol. Its IUPAC name is 4-[4-[(E)-indol-3-ylidenemethyl]-5-methyl-3-oxo-1H-pyrazol-2-yl]benzenesulfonic acid.
| Compound Name | 4-[4-[(E)-indol-3-ylidenemethyl]-5-methyl-3-oxo-1H-pyrazol-2-yl]benzenesulfonic acid |
|---|---|
| PubChem CID | 18339050 |
| Molecular Formula | C19H15N3O4S |
| Molecular Weight | 381.41 g/mol |
| Exact Mass | 381.08 |
| IUPAC Name | 4-[4-[(E)-indol-3-ylidenemethyl]-5-methyl-3-oxo-1H-pyrazol-2-yl]benzenesulfonic acid |
| SMILES | Cc1[nH]n(-c2ccc(S(=O)(=O)O)cc2)c(=O)c1/C=C1/C=Nc2ccccc21 |
| InChI | InChI=1S/C19H15N3O4S/c1-12-17(10-13-11-20-18-5-3-2-4-16(13)18)19(23)22(21-12)14-6-8-15(9-7-14)27(24,25)26/h2-11,21H,1H3,(H,24,25,26)/b13-10- |
| InChIKey | CCWYEAHIGCEGQS-RAXLEYEMSA-N |
| XLogP | 2.98 |
| TPSA | 104.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.41 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|