C20H14ClN3O3 — CID 1252549
2-chloro-5-[4-(indol-3-ylidenemethyl)-5-methyl-3-oxo-1H-pyrazol-2-yl]benzoic acid (PubChem CID 1252549) has the molecular formula C20H14ClN3O3 and a molecular weight of 379.80 g/mol. Its IUPAC name is 2-chloro-5-[4-(indol-3-ylidenemethyl)-5-methyl-3-oxo-1H-pyrazol-2-yl]benzoic acid.
| Compound Name | 2-chloro-5-[4-(indol-3-ylidenemethyl)-5-methyl-3-oxo-1H-pyrazol-2-yl]benzoic acid |
|---|---|
| PubChem CID | 1252549 |
| Molecular Formula | C20H14ClN3O3 |
| Molecular Weight | 379.80 g/mol |
| Exact Mass | 379.07 |
| IUPAC Name | 2-chloro-5-[4-(indol-3-ylidenemethyl)-5-methyl-3-oxo-1H-pyrazol-2-yl]benzoic acid |
| SMILES | Cc1[nH]n(-c2ccc(Cl)c(C(=O)O)c2)c(=O)c1C=C1C=Nc2ccccc21 |
| InChI | InChI=1S/C20H14ClN3O3/c1-11-15(8-12-10-22-18-5-3-2-4-14(12)18)19(25)24(23-11)13-6-7-17(21)16(9-13)20(26)27/h2-10,23H,1H3,(H,26,27) |
| InChIKey | RCAHZCWIKRYMEV-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 87.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.80 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |