C26H26N4O4S — CID 135927450
ethyl 2-[[(2R)-2-[methyl-[(4-oxo-3H-quinazolin-2-yl)methyl]amino]propanoyl]amino]-4-phenylthiophene-3-carboxylate (PubChem CID 135927450) has the molecular formula C26H26N4O4S and a molecular weight of 490.59 g/mol. Its IUPAC name is ethyl 2-[[(2R)-2-[methyl-[(4-oxo-3H-quinazolin-2-yl)methyl]amino]propanoyl]amino]-4-phenylthiophene-3-carboxylate.
| Compound Name | ethyl 2-[[(2R)-2-[methyl-[(4-oxo-3H-quinazolin-2-yl)methyl]amino]propanoyl]amino]-4-phenylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 135927450 |
| Molecular Formula | C26H26N4O4S |
| Molecular Weight | 490.59 g/mol |
| Exact Mass | 490.17 |
| IUPAC Name | ethyl 2-[[(2R)-2-[methyl-[(4-oxo-3H-quinazolin-2-yl)methyl]amino]propanoyl]amino]-4-phenylthiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccccc2)csc1NC(=O)[C@@H](C)N(C)Cc1nc2ccccc2c(=O)[nH]1 |
| InChI | InChI=1S/C26H26N4O4S/c1-4-34-26(33)22-19(17-10-6-5-7-11-17)15-35-25(22)29-23(31)16(2)30(3)14-21-27-20-13-9-8-12-18(20)24(32)28-21/h5-13,15-16H,4,14H2,1-3H3,(H,29,31)(H,27,28,32)/t16-/m1/s1 |
| InChIKey | ZOSNJJJCGXUPSP-MRXNPFEDSA-N |
| XLogP | 4.29 |
| TPSA | 104.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.59 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|