C10H10N6O3 — CID 135933691
N-[(Z)-(2,4-dihydroxyphenyl)methylideneamino]-2-(tetrazol-1-yl)acetamide (PubChem CID 135933691) has the molecular formula C10H10N6O3 and a molecular weight of 262.23 g/mol. Its IUPAC name is N-[(Z)-(2,4-dihydroxyphenyl)methylideneamino]-2-(tetrazol-1-yl)acetamide.
| Compound Name | N-[(Z)-(2,4-dihydroxyphenyl)methylideneamino]-2-(tetrazol-1-yl)acetamide |
|---|---|
| PubChem CID | 135933691 |
| Molecular Formula | C10H10N6O3 |
| Molecular Weight | 262.23 g/mol |
| Exact Mass | 262.08 |
| IUPAC Name | N-[(Z)-(2,4-dihydroxyphenyl)methylideneamino]-2-(tetrazol-1-yl)acetamide |
| SMILES | O=C(Cn1cnnn1)N/N=C\c1ccc(O)cc1O |
| InChI | InChI=1S/C10H10N6O3/c17-8-2-1-7(9(18)3-8)4-11-13-10(19)5-16-6-12-14-15-16/h1-4,6,17-18H,5H2,(H,13,19)/b11-4- |
| InChIKey | NHADGJUCCDJRDD-WCIBSUBMSA-N |
| XLogP | -0.77 |
| TPSA | 125.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.23 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|