C15H21N3O — CID 135934866
1-[3-methoxy-5-(1H-pyrrol-2-yl)-1H-pyrrol-2-yl]-N-(3-methylbutyl)methanimine (PubChem CID 135934866) has the molecular formula C15H21N3O and a molecular weight of 259.35 g/mol. Its IUPAC name is 1-[3-methoxy-5-(1H-pyrrol-2-yl)-1H-pyrrol-2-yl]-N-(3-methylbutyl)methanimine.
| Compound Name | 1-[3-methoxy-5-(1H-pyrrol-2-yl)-1H-pyrrol-2-yl]-N-(3-methylbutyl)methanimine |
|---|---|
| PubChem CID | 135934866 |
| Molecular Formula | C15H21N3O |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.17 |
| IUPAC Name | 1-[3-methoxy-5-(1H-pyrrol-2-yl)-1H-pyrrol-2-yl]-N-(3-methylbutyl)methanimine |
| SMILES | COc1cc(-c2ccc[nH]2)[nH]c1/C=N/CCC(C)C |
| InChI | InChI=1S/C15H21N3O/c1-11(2)6-8-16-10-14-15(19-3)9-13(18-14)12-5-4-7-17-12/h4-5,7,9-11,17-18H,6,8H2,1-3H3/b16-10+ |
| InChIKey | USHIDYLHTWWNTK-MHWRWJLKSA-N |
| XLogP | 3.48 |
| TPSA | 53.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|