C15H10N2O5S — CID 135935059
2-[[(5Z)-5-(furan-2-ylmethylidene)-4-oxo-1,3-thiazolidin-2-ylidene]amino]-5-hydroxybenzoic acid (PubChem CID 135935059) has the molecular formula C15H10N2O5S and a molecular weight of 330.32 g/mol. Its IUPAC name is 2-[[(5Z)-5-(furan-2-ylmethylidene)-4-oxo-1,3-thiazolidin-2-ylidene]amino]-5-hydroxybenzoic acid.
| Compound Name | 2-[[(5Z)-5-(furan-2-ylmethylidene)-4-oxo-1,3-thiazolidin-2-ylidene]amino]-5-hydroxybenzoic acid |
|---|---|
| PubChem CID | 135935059 |
| Molecular Formula | C15H10N2O5S |
| Molecular Weight | 330.32 g/mol |
| Exact Mass | 330.03 |
| IUPAC Name | 2-[[(5Z)-5-(furan-2-ylmethylidene)-4-oxo-1,3-thiazolidin-2-ylidene]amino]-5-hydroxybenzoic acid |
| SMILES | O=C1N/C(=N\c2ccc(O)cc2C(=O)O)S/C1=C\c1ccco1 |
| InChI | InChI=1S/C15H10N2O5S/c18-8-3-4-11(10(6-8)14(20)21)16-15-17-13(19)12(23-15)7-9-2-1-5-22-9/h1-7,18H,(H,20,21)(H,16,17,19)/b12-7- |
| InChIKey | UQIQIYJIPPWPFH-GHXNOFRVSA-N |
| XLogP | 2.58 |
| TPSA | 112.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.32 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_C(13)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|