C23H23N5O6 — CID 135935488
(7S)-7-(1,3-benzodioxol-5-yl)-5-methyl-2-(3,4,5-trimethoxyphenyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide (PubChem CID 135935488) has the molecular formula C23H23N5O6 and a molecular weight of 465.47 g/mol. Its IUPAC name is (7S)-7-(1,3-benzodioxol-5-yl)-5-methyl-2-(3,4,5-trimethoxyphenyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide.
| Compound Name | (7S)-7-(1,3-benzodioxol-5-yl)-5-methyl-2-(3,4,5-trimethoxyphenyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 135935488 |
| Molecular Formula | C23H23N5O6 |
| Molecular Weight | 465.47 g/mol |
| Exact Mass | 465.16 |
| IUPAC Name | (7S)-7-(1,3-benzodioxol-5-yl)-5-methyl-2-(3,4,5-trimethoxyphenyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
| SMILES | COc1cc(-c2nc3n(n2)[C@@H](c2ccc4c(c2)OCO4)C(C(N)=O)=C(C)N3)cc(OC)c1OC |
| InChI | InChI=1S/C23H23N5O6/c1-11-18(21(24)29)19(12-5-6-14-15(7-12)34-10-33-14)28-23(25-11)26-22(27-28)13-8-16(30-2)20(32-4)17(9-13)31-3/h5-9,19H,10H2,1-4H3,(H2,24,29)(H,25,26,27)/t19-/m0/s1 |
| InChIKey | POSVARWOQLUPEK-IBGZPJMESA-N |
| XLogP | 2.47 |
| TPSA | 131.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.47 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |