C24H19N5O3 — CID 135692996
7-(1,3-benzodioxol-5-yl)-5-methyl-2-naphthalen-1-yl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide (PubChem CID 135692996) has the molecular formula C24H19N5O3 and a molecular weight of 425.45 g/mol. Its IUPAC name is 7-(1,3-benzodioxol-5-yl)-5-methyl-2-naphthalen-1-yl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide.
| Compound Name | 7-(1,3-benzodioxol-5-yl)-5-methyl-2-naphthalen-1-yl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 135692996 |
| Molecular Formula | C24H19N5O3 |
| Molecular Weight | 425.45 g/mol |
| Exact Mass | 425.15 |
| IUPAC Name | 7-(1,3-benzodioxol-5-yl)-5-methyl-2-naphthalen-1-yl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
| SMILES | CC1=C(C(N)=O)C(c2ccc3c(c2)OCO3)n2nc(-c3cccc4ccccc34)nc2N1 |
| InChI | InChI=1S/C24H19N5O3/c1-13-20(22(25)30)21(15-9-10-18-19(11-15)32-12-31-18)29-24(26-13)27-23(28-29)17-8-4-6-14-5-2-3-7-16(14)17/h2-11,21H,12H2,1H3,(H2,25,30)(H,26,27,28) |
| InChIKey | GGAWMYSQPIPZMK-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 104.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.45 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |