C28H25N5O3 — CID 135704161
7-(1,3-benzodioxol-5-yl)-2-(3,4-dimethylphenyl)-5-methyl-N-phenyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide (PubChem CID 135704161) has the molecular formula C28H25N5O3 and a molecular weight of 479.54 g/mol. Its IUPAC name is 7-(1,3-benzodioxol-5-yl)-2-(3,4-dimethylphenyl)-5-methyl-N-phenyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide.
| Compound Name | 7-(1,3-benzodioxol-5-yl)-2-(3,4-dimethylphenyl)-5-methyl-N-phenyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 135704161 |
| Molecular Formula | C28H25N5O3 |
| Molecular Weight | 479.54 g/mol |
| Exact Mass | 479.20 |
| IUPAC Name | 7-(1,3-benzodioxol-5-yl)-2-(3,4-dimethylphenyl)-5-methyl-N-phenyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
| SMILES | CC1=C(C(=O)Nc2ccccc2)C(c2ccc3c(c2)OCO3)n2nc(-c3ccc(C)c(C)c3)nc2N1 |
| InChI | InChI=1S/C28H25N5O3/c1-16-9-10-20(13-17(16)2)26-31-28-29-18(3)24(27(34)30-21-7-5-4-6-8-21)25(33(28)32-26)19-11-12-22-23(14-19)36-15-35-22/h4-14,25H,15H2,1-3H3,(H,30,34)(H,29,31,32) |
| InChIKey | XFHFSHCHHAUICE-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 90.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.54 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |