C26H24N6O — CID 135843191
2-(3,4-dimethylphenyl)-5-methyl-N-phenyl-7-pyridin-4-yl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide (PubChem CID 135843191) has the molecular formula C26H24N6O and a molecular weight of 436.52 g/mol. Its IUPAC name is 2-(3,4-dimethylphenyl)-5-methyl-N-phenyl-7-pyridin-4-yl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide.
| Compound Name | 2-(3,4-dimethylphenyl)-5-methyl-N-phenyl-7-pyridin-4-yl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 135843191 |
| Molecular Formula | C26H24N6O |
| Molecular Weight | 436.52 g/mol |
| Exact Mass | 436.20 |
| IUPAC Name | 2-(3,4-dimethylphenyl)-5-methyl-N-phenyl-7-pyridin-4-yl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
| SMILES | CC1=C(C(=O)Nc2ccccc2)C(c2ccncc2)n2nc(-c3ccc(C)c(C)c3)nc2N1 |
| InChI | InChI=1S/C26H24N6O/c1-16-9-10-20(15-17(16)2)24-30-26-28-18(3)22(25(33)29-21-7-5-4-6-8-21)23(32(26)31-24)19-11-13-27-14-12-19/h4-15,23H,1-3H3,(H,29,33)(H,28,30,31) |
| InChIKey | SYWBMUJOFVNOOW-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.52 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |