C25H18Cl2FN5O — CID 135591989
7-(3,4-dichlorophenyl)-2-(4-fluorophenyl)-5-methyl-N-phenyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide (PubChem CID 135591989) has the molecular formula C25H18Cl2FN5O and a molecular weight of 494.36 g/mol. Its IUPAC name is 7-(3,4-dichlorophenyl)-2-(4-fluorophenyl)-5-methyl-N-phenyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide.
| Compound Name | 7-(3,4-dichlorophenyl)-2-(4-fluorophenyl)-5-methyl-N-phenyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 135591989 |
| Molecular Formula | C25H18Cl2FN5O |
| Molecular Weight | 494.36 g/mol |
| Exact Mass | 493.09 |
| IUPAC Name | 7-(3,4-dichlorophenyl)-2-(4-fluorophenyl)-5-methyl-N-phenyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
| SMILES | CC1=C(C(=O)Nc2ccccc2)C(c2ccc(Cl)c(Cl)c2)n2nc(-c3ccc(F)cc3)nc2N1 |
| InChI | InChI=1S/C25H18Cl2FN5O/c1-14-21(24(34)30-18-5-3-2-4-6-18)22(16-9-12-19(26)20(27)13-16)33-25(29-14)31-23(32-33)15-7-10-17(28)11-8-15/h2-13,22H,1H3,(H,30,34)(H,29,31,32) |
| InChIKey | CMPNGRIYIMIRQR-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.36 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |