C27H23Cl2N5O3 — CID 135723254
2-(3,4-dichlorophenyl)-7-(2,3-dimethoxyphenyl)-5-methyl-N-phenyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide (PubChem CID 135723254) has the molecular formula C27H23Cl2N5O3 and a molecular weight of 536.42 g/mol. Its IUPAC name is 2-(3,4-dichlorophenyl)-7-(2,3-dimethoxyphenyl)-5-methyl-N-phenyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide.
| Compound Name | 2-(3,4-dichlorophenyl)-7-(2,3-dimethoxyphenyl)-5-methyl-N-phenyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 135723254 |
| Molecular Formula | C27H23Cl2N5O3 |
| Molecular Weight | 536.42 g/mol |
| Exact Mass | 535.12 |
| IUPAC Name | 2-(3,4-dichlorophenyl)-7-(2,3-dimethoxyphenyl)-5-methyl-N-phenyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
| SMILES | COc1cccc(C2C(C(=O)Nc3ccccc3)=C(C)Nc3nc(-c4ccc(Cl)c(Cl)c4)nn32)c1OC |
| InChI | InChI=1S/C27H23Cl2N5O3/c1-15-22(26(35)31-17-8-5-4-6-9-17)23(18-10-7-11-21(36-2)24(18)37-3)34-27(30-15)32-25(33-34)16-12-13-19(28)20(29)14-16/h4-14,23H,1-3H3,(H,31,35)(H,30,32,33) |
| InChIKey | XZFKZHMOSMBLHQ-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 90.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.42 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |