C19H15Cl2N5O3 — CID 135938267
(7R)-N-(3,4-dichlorophenyl)-2-(4-methoxyphenyl)-5-oxo-6,7-dihydro-4H-[1,2,4]triazolo[1,5-a]pyrimidine-7-carboxamide (PubChem CID 135938267) has the molecular formula C19H15Cl2N5O3 and a molecular weight of 432.27 g/mol. Its IUPAC name is (7R)-N-(3,4-dichlorophenyl)-2-(4-methoxyphenyl)-5-oxo-6,7-dihydro-4H-[1,2,4]triazolo[1,5-a]pyrimidine-7-carboxamide.
| Compound Name | (7R)-N-(3,4-dichlorophenyl)-2-(4-methoxyphenyl)-5-oxo-6,7-dihydro-4H-[1,2,4]triazolo[1,5-a]pyrimidine-7-carboxamide |
|---|---|
| PubChem CID | 135938267 |
| Molecular Formula | C19H15Cl2N5O3 |
| Molecular Weight | 432.27 g/mol |
| Exact Mass | 431.06 |
| IUPAC Name | (7R)-N-(3,4-dichlorophenyl)-2-(4-methoxyphenyl)-5-oxo-6,7-dihydro-4H-[1,2,4]triazolo[1,5-a]pyrimidine-7-carboxamide |
| SMILES | COc1ccc(-c2nc3n(n2)[C@@H](C(=O)Nc2ccc(Cl)c(Cl)c2)CC(=O)N3)cc1 |
| InChI | InChI=1S/C19H15Cl2N5O3/c1-29-12-5-2-10(3-6-12)17-24-19-23-16(27)9-15(26(19)25-17)18(28)22-11-4-7-13(20)14(21)8-11/h2-8,15H,9H2,1H3,(H,22,28)(H,23,24,25,27)/t15-/m1/s1 |
| InChIKey | NNIKPHMVPIYQNZ-OAHLLOKOSA-N |
| XLogP | 3.78 |
| TPSA | 98.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.27 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |