C21H21N5O3 — CID 4976443
N-(2,4-dimethylphenyl)-2-(4-methoxyphenyl)-5-oxo-6,7-dihydro-4H-[1,2,4]triazolo[1,5-a]pyrimidine-7-carboxamide (PubChem CID 4976443) has the molecular formula C21H21N5O3 and a molecular weight of 391.43 g/mol. Its IUPAC name is N-(2,4-dimethylphenyl)-2-(4-methoxyphenyl)-5-oxo-6,7-dihydro-4H-[1,2,4]triazolo[1,5-a]pyrimidine-7-carboxamide.
| Compound Name | N-(2,4-dimethylphenyl)-2-(4-methoxyphenyl)-5-oxo-6,7-dihydro-4H-[1,2,4]triazolo[1,5-a]pyrimidine-7-carboxamide |
|---|---|
| PubChem CID | 4976443 |
| Molecular Formula | C21H21N5O3 |
| Molecular Weight | 391.43 g/mol |
| Exact Mass | 391.16 |
| IUPAC Name | N-(2,4-dimethylphenyl)-2-(4-methoxyphenyl)-5-oxo-6,7-dihydro-4H-[1,2,4]triazolo[1,5-a]pyrimidine-7-carboxamide |
| SMILES | COc1ccc(-c2nc3n(n2)C(C(=O)Nc2ccc(C)cc2C)CC(=O)N3)cc1 |
| InChI | InChI=1S/C21H21N5O3/c1-12-4-9-16(13(2)10-12)22-20(28)17-11-18(27)23-21-24-19(25-26(17)21)14-5-7-15(29-3)8-6-14/h4-10,17H,11H2,1-3H3,(H,22,28)(H,23,24,25,27) |
| InChIKey | MGZJJZYTKSNHAU-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 98.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.43 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |