C18H23N5O4 — CID 135601523
(7S)-N-(2,4-dimethylphenyl)-2-(2-methoxyethoxymethyl)-5-oxo-6,7-dihydro-4H-[1,2,4]triazolo[1,5-a]pyrimidine-7-carboxamide (PubChem CID 135601523) has the molecular formula C18H23N5O4 and a molecular weight of 373.41 g/mol. Its IUPAC name is (7S)-N-(2,4-dimethylphenyl)-2-(2-methoxyethoxymethyl)-5-oxo-6,7-dihydro-4H-[1,2,4]triazolo[1,5-a]pyrimidine-7-carboxamide.
| Compound Name | (7S)-N-(2,4-dimethylphenyl)-2-(2-methoxyethoxymethyl)-5-oxo-6,7-dihydro-4H-[1,2,4]triazolo[1,5-a]pyrimidine-7-carboxamide |
|---|---|
| PubChem CID | 135601523 |
| Molecular Formula | C18H23N5O4 |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.18 |
| IUPAC Name | (7S)-N-(2,4-dimethylphenyl)-2-(2-methoxyethoxymethyl)-5-oxo-6,7-dihydro-4H-[1,2,4]triazolo[1,5-a]pyrimidine-7-carboxamide |
| SMILES | COCCOCc1nc2n(n1)[C@H](C(=O)Nc1ccc(C)cc1C)CC(=O)N2 |
| InChI | InChI=1S/C18H23N5O4/c1-11-4-5-13(12(2)8-11)19-17(25)14-9-16(24)21-18-20-15(22-23(14)18)10-27-7-6-26-3/h4-5,8,14H,6-7,9-10H2,1-3H3,(H,19,25)(H,20,21,22,24)/t14-/m0/s1 |
| InChIKey | XHKGOICYCFIPQP-AWEZNQCLSA-N |
| XLogP | 1.58 |
| TPSA | 107.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|