C15H14F3N5O4 — CID 4899941
N-(2,4-dimethoxyphenyl)-5-oxo-2-(trifluoromethyl)-6,7-dihydro-4H-[1,2,4]triazolo[1,5-a]pyrimidine-7-carboxamide (PubChem CID 4899941) has the molecular formula C15H14F3N5O4 and a molecular weight of 385.30 g/mol. Its IUPAC name is N-(2,4-dimethoxyphenyl)-5-oxo-2-(trifluoromethyl)-6,7-dihydro-4H-[1,2,4]triazolo[1,5-a]pyrimidine-7-carboxamide.
| Compound Name | N-(2,4-dimethoxyphenyl)-5-oxo-2-(trifluoromethyl)-6,7-dihydro-4H-[1,2,4]triazolo[1,5-a]pyrimidine-7-carboxamide |
|---|---|
| PubChem CID | 4899941 |
| Molecular Formula | C15H14F3N5O4 |
| Molecular Weight | 385.30 g/mol |
| Exact Mass | 385.10 |
| IUPAC Name | N-(2,4-dimethoxyphenyl)-5-oxo-2-(trifluoromethyl)-6,7-dihydro-4H-[1,2,4]triazolo[1,5-a]pyrimidine-7-carboxamide |
| SMILES | COc1ccc(NC(=O)C2CC(=O)Nc3nc(C(F)(F)F)nn32)c(OC)c1 |
| InChI | InChI=1S/C15H14F3N5O4/c1-26-7-3-4-8(10(5-7)27-2)19-12(25)9-6-11(24)20-14-21-13(15(16,17)18)22-23(9)14/h3-5,9H,6H2,1-2H3,(H,19,25)(H,20,21,22,24) |
| InChIKey | ALGOJTMOFAJRCG-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 107.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.30 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |