C22H20N4O2 — CID 135940703
(3R)-1'-(3,5-dimethylphenyl)-7-methylspiro[1H-indole-3,4'-5,7-dihydropyrazolo[5,4-b]pyridine]-2,6'-dione (PubChem CID 135940703) has the molecular formula C22H20N4O2 and a molecular weight of 372.43 g/mol. Its IUPAC name is (3R)-1'-(3,5-dimethylphenyl)-7-methylspiro[1H-indole-3,4'-5,7-dihydropyrazolo[5,4-b]pyridine]-2,6'-dione.
| Compound Name | (3R)-1'-(3,5-dimethylphenyl)-7-methylspiro[1H-indole-3,4'-5,7-dihydropyrazolo[5,4-b]pyridine]-2,6'-dione |
|---|---|
| PubChem CID | 135940703 |
| Molecular Formula | C22H20N4O2 |
| Molecular Weight | 372.43 g/mol |
| Exact Mass | 372.16 |
| IUPAC Name | (3R)-1'-(3,5-dimethylphenyl)-7-methylspiro[1H-indole-3,4'-5,7-dihydropyrazolo[5,4-b]pyridine]-2,6'-dione |
| SMILES | Cc1cc(C)cc(-n2ncc3c2NC(=O)C[C@]32C(=O)Nc3c(C)cccc32)c1 |
| InChI | InChI=1S/C22H20N4O2/c1-12-7-13(2)9-15(8-12)26-20-17(11-23-26)22(10-18(27)24-20)16-6-4-5-14(3)19(16)25-21(22)28/h4-9,11H,10H2,1-3H3,(H,24,27)(H,25,28)/t22-/m1/s1 |
| InChIKey | MVKINKRXDONWAD-JOCHJYFZSA-N |
| XLogP | 3.38 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.43 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |