C25H22N4O2 — CID 135940784
(4S)-1-(3,4-dimethylphenyl)-7'-methyl-1'-prop-2-ynylspiro[5,7-dihydropyrazolo[5,4-b]pyridine-4,3'-indole]-2',6-dione (PubChem CID 135940784) has the molecular formula C25H22N4O2 and a molecular weight of 410.48 g/mol. Its IUPAC name is (4S)-1-(3,4-dimethylphenyl)-7'-methyl-1'-prop-2-ynylspiro[5,7-dihydropyrazolo[5,4-b]pyridine-4,3'-indole]-2',6-dione.
| Compound Name | (4S)-1-(3,4-dimethylphenyl)-7'-methyl-1'-prop-2-ynylspiro[5,7-dihydropyrazolo[5,4-b]pyridine-4,3'-indole]-2',6-dione |
|---|---|
| PubChem CID | 135940784 |
| Molecular Formula | C25H22N4O2 |
| Molecular Weight | 410.48 g/mol |
| Exact Mass | 410.17 |
| IUPAC Name | (4S)-1-(3,4-dimethylphenyl)-7'-methyl-1'-prop-2-ynylspiro[5,7-dihydropyrazolo[5,4-b]pyridine-4,3'-indole]-2',6-dione |
| SMILES | C#CCN1C(=O)[C@@]2(CC(=O)Nc3c2cnn3-c2ccc(C)c(C)c2)c2cccc(C)c21 |
| InChI | InChI=1S/C25H22N4O2/c1-5-11-28-22-16(3)7-6-8-19(22)25(24(28)31)13-21(30)27-23-20(25)14-26-29(23)18-10-9-15(2)17(4)12-18/h1,6-10,12,14H,11,13H2,2-4H3,(H,27,30)/t25-/m0/s1 |
| InChIKey | XTPGFLXFTVTEIG-VWLOTQADSA-N |
| XLogP | 3.41 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.48 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|