C25H26N4O2 — CID 135654919
1-(3,4-dimethylphenyl)-1'-(2-methylpropyl)spiro[5,7-dihydropyrazolo[5,4-b]pyridine-4,3'-indole]-2',6-dione (PubChem CID 135654919) has the molecular formula C25H26N4O2 and a molecular weight of 414.51 g/mol. Its IUPAC name is 1-(3,4-dimethylphenyl)-1'-(2-methylpropyl)spiro[5,7-dihydropyrazolo[5,4-b]pyridine-4,3'-indole]-2',6-dione.
| Compound Name | 1-(3,4-dimethylphenyl)-1'-(2-methylpropyl)spiro[5,7-dihydropyrazolo[5,4-b]pyridine-4,3'-indole]-2',6-dione |
|---|---|
| PubChem CID | 135654919 |
| Molecular Formula | C25H26N4O2 |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.21 |
| IUPAC Name | 1-(3,4-dimethylphenyl)-1'-(2-methylpropyl)spiro[5,7-dihydropyrazolo[5,4-b]pyridine-4,3'-indole]-2',6-dione |
| SMILES | Cc1ccc(-n2ncc3c2NC(=O)CC32C(=O)N(CC(C)C)c3ccccc32)cc1C |
| InChI | InChI=1S/C25H26N4O2/c1-15(2)14-28-21-8-6-5-7-19(21)25(24(28)31)12-22(30)27-23-20(25)13-26-29(23)18-10-9-16(3)17(4)11-18/h5-11,13,15H,12,14H2,1-4H3,(H,27,30) |
| InChIKey | JOSWXORBRASBDL-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |