C23H24N6O — CID 135942735
2-(4-aminophenyl)-6-[(1-ethylbenzimidazol-2-yl)methyl]-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one (PubChem CID 135942735) has the molecular formula C23H24N6O and a molecular weight of 400.49 g/mol. Its IUPAC name is 2-(4-aminophenyl)-6-[(1-ethylbenzimidazol-2-yl)methyl]-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one.
| Compound Name | 2-(4-aminophenyl)-6-[(1-ethylbenzimidazol-2-yl)methyl]-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 135942735 |
| Molecular Formula | C23H24N6O |
| Molecular Weight | 400.49 g/mol |
| Exact Mass | 400.20 |
| IUPAC Name | 2-(4-aminophenyl)-6-[(1-ethylbenzimidazol-2-yl)methyl]-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
| SMILES | CCn1c(CN2CCc3nc(-c4ccc(N)cc4)[nH]c(=O)c3C2)nc2ccccc21 |
| InChI | InChI=1S/C23H24N6O/c1-2-29-20-6-4-3-5-19(20)25-21(29)14-28-12-11-18-17(13-28)23(30)27-22(26-18)15-7-9-16(24)10-8-15/h3-10H,2,11-14,24H2,1H3,(H,26,27,30) |
| InChIKey | OZDIGXJWXFLSPI-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 92.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.49 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|