C26H23ClN4O2 — CID 135943018
3-[[2-(4-chlorophenyl)-4-oxo-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-6-yl]methyl]-1-azatricyclo[7.3.1.05,13]trideca-3,5(13),6,8-tetraen-2-one (PubChem CID 135943018) has the molecular formula C26H23ClN4O2 and a molecular weight of 458.95 g/mol. Its IUPAC name is 3-[[2-(4-chlorophenyl)-4-oxo-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-6-yl]methyl]-1-azatricyclo[7.3.1.05,13]trideca-3,5(13),6,8-tetraen-2-one.
| Compound Name | 3-[[2-(4-chlorophenyl)-4-oxo-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-6-yl]methyl]-1-azatricyclo[7.3.1.05,13]trideca-3,5(13),6,8-tetraen-2-one |
|---|---|
| PubChem CID | 135943018 |
| Molecular Formula | C26H23ClN4O2 |
| Molecular Weight | 458.95 g/mol |
| Exact Mass | 458.15 |
| IUPAC Name | 3-[[2-(4-chlorophenyl)-4-oxo-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-6-yl]methyl]-1-azatricyclo[7.3.1.05,13]trideca-3,5(13),6,8-tetraen-2-one |
| SMILES | O=c1[nH]c(-c2ccc(Cl)cc2)nc2c1CN(Cc1cc3cccc4c3n(c1=O)CCC4)CC2 |
| InChI | InChI=1S/C26H23ClN4O2/c27-20-8-6-17(7-9-20)24-28-22-10-12-30(15-21(22)25(32)29-24)14-19-13-18-4-1-3-16-5-2-11-31(23(16)18)26(19)33/h1,3-4,6-9,13H,2,5,10-12,14-15H2,(H,28,29,32) |
| InChIKey | LFWWENPUXDSLMZ-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 70.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.95 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |