C26H23ClN4O — CID 24911466
3-[[2-(4-chlorophenyl)-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl]methyl]-1-azatricyclo[7.3.1.05,13]trideca-3,5(13),6,8-tetraen-2-one (PubChem CID 24911466) has the molecular formula C26H23ClN4O and a molecular weight of 442.95 g/mol. Its IUPAC name is 3-[[2-(4-chlorophenyl)-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl]methyl]-1-azatricyclo[7.3.1.05,13]trideca-3,5(13),6,8-tetraen-2-one.
| Compound Name | 3-[[2-(4-chlorophenyl)-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl]methyl]-1-azatricyclo[7.3.1.05,13]trideca-3,5(13),6,8-tetraen-2-one |
|---|---|
| PubChem CID | 24911466 |
| Molecular Formula | C26H23ClN4O |
| Molecular Weight | 442.95 g/mol |
| Exact Mass | 442.16 |
| IUPAC Name | 3-[[2-(4-chlorophenyl)-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl]methyl]-1-azatricyclo[7.3.1.05,13]trideca-3,5(13),6,8-tetraen-2-one |
| SMILES | O=c1c(CN2CCc3nc(-c4ccc(Cl)cc4)ncc3C2)cc2cccc3c2n1CCC3 |
| InChI | InChI=1S/C26H23ClN4O/c27-22-8-6-18(7-9-22)25-28-14-21-16-30(12-10-23(21)29-25)15-20-13-19-4-1-3-17-5-2-11-31(24(17)19)26(20)32/h1,3-4,6-9,13-14H,2,5,10-12,15-16H2 |
| InChIKey | IWWPPYUCNJHDJE-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.95 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |