C24H20Cl2N4 — CID 24912306
6-[(2-chloro-8-methylquinolin-3-yl)methyl]-2-(4-chlorophenyl)-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine (PubChem CID 24912306) has the molecular formula C24H20Cl2N4 and a molecular weight of 435.36 g/mol. Its IUPAC name is 6-[(2-chloro-8-methylquinolin-3-yl)methyl]-2-(4-chlorophenyl)-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine.
| Compound Name | 6-[(2-chloro-8-methylquinolin-3-yl)methyl]-2-(4-chlorophenyl)-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine |
|---|---|
| PubChem CID | 24912306 |
| Molecular Formula | C24H20Cl2N4 |
| Molecular Weight | 435.36 g/mol |
| Exact Mass | 434.11 |
| IUPAC Name | 6-[(2-chloro-8-methylquinolin-3-yl)methyl]-2-(4-chlorophenyl)-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine |
| SMILES | Cc1cccc2cc(CN3CCc4nc(-c5ccc(Cl)cc5)ncc4C3)c(Cl)nc12 |
| InChI | InChI=1S/C24H20Cl2N4/c1-15-3-2-4-17-11-18(23(26)29-22(15)17)13-30-10-9-21-19(14-30)12-27-24(28-21)16-5-7-20(25)8-6-16/h2-8,11-12H,9-10,13-14H2,1H3 |
| InChIKey | KMSOKYXPPOJMJY-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.36 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|