C24H21ClN4 — CID 24911410
6-[(2-chloro-7-methylquinolin-3-yl)methyl]-2-phenyl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine (PubChem CID 24911410) has the molecular formula C24H21ClN4 and a molecular weight of 400.91 g/mol. Its IUPAC name is 6-[(2-chloro-7-methylquinolin-3-yl)methyl]-2-phenyl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine.
| Compound Name | 6-[(2-chloro-7-methylquinolin-3-yl)methyl]-2-phenyl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine |
|---|---|
| PubChem CID | 24911410 |
| Molecular Formula | C24H21ClN4 |
| Molecular Weight | 400.91 g/mol |
| Exact Mass | 400.15 |
| IUPAC Name | 6-[(2-chloro-7-methylquinolin-3-yl)methyl]-2-phenyl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine |
| SMILES | Cc1ccc2cc(CN3CCc4nc(-c5ccccc5)ncc4C3)c(Cl)nc2c1 |
| InChI | InChI=1S/C24H21ClN4/c1-16-7-8-18-12-19(23(25)27-22(18)11-16)14-29-10-9-21-20(15-29)13-26-24(28-21)17-5-3-2-4-6-17/h2-8,11-13H,9-10,14-15H2,1H3 |
| InChIKey | GLQVXTMIJJXVEK-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.91 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|