C24H22ClN5O — CID 24910224
4-[6-[(2-chloro-6-methoxyquinolin-3-yl)methyl]-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-2-yl]aniline (PubChem CID 24910224) has the molecular formula C24H22ClN5O and a molecular weight of 431.93 g/mol. Its IUPAC name is 4-[6-[(2-chloro-6-methoxyquinolin-3-yl)methyl]-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-2-yl]aniline.
| Compound Name | 4-[6-[(2-chloro-6-methoxyquinolin-3-yl)methyl]-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-2-yl]aniline |
|---|---|
| PubChem CID | 24910224 |
| Molecular Formula | C24H22ClN5O |
| Molecular Weight | 431.93 g/mol |
| Exact Mass | 431.15 |
| IUPAC Name | 4-[6-[(2-chloro-6-methoxyquinolin-3-yl)methyl]-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-2-yl]aniline |
| SMILES | COc1ccc2nc(Cl)c(CN3CCc4nc(-c5ccc(N)cc5)ncc4C3)cc2c1 |
| InChI | InChI=1S/C24H22ClN5O/c1-31-20-6-7-21-16(11-20)10-17(23(25)28-21)13-30-9-8-22-18(14-30)12-27-24(29-22)15-2-4-19(26)5-3-15/h2-7,10-12H,8-9,13-14,26H2,1H3 |
| InChIKey | NQVQGVDIWICOJO-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 77.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.93 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|