C22H24N4O3 — CID 24928959
4-[[2-(4-aminophenyl)-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl]methyl]-3,5-dimethoxyphenol (PubChem CID 24928959) has the molecular formula C22H24N4O3 and a molecular weight of 392.46 g/mol. Its IUPAC name is 4-[[2-(4-aminophenyl)-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl]methyl]-3,5-dimethoxyphenol.
| Compound Name | 4-[[2-(4-aminophenyl)-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl]methyl]-3,5-dimethoxyphenol |
|---|---|
| PubChem CID | 24928959 |
| Molecular Formula | C22H24N4O3 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | 4-[[2-(4-aminophenyl)-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl]methyl]-3,5-dimethoxyphenol |
| SMILES | COc1cc(O)cc(OC)c1CN1CCc2nc(-c3ccc(N)cc3)ncc2C1 |
| InChI | InChI=1S/C22H24N4O3/c1-28-20-9-17(27)10-21(29-2)18(20)13-26-8-7-19-15(12-26)11-24-22(25-19)14-3-5-16(23)6-4-14/h3-6,9-11,27H,7-8,12-13,23H2,1-2H3 |
| InChIKey | CMYMVCDTHNHBKA-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|