C20H18ClN3O3 — CID 24928479
2-[[2-(4-chlorophenyl)-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl]methyl]benzene-1,3,5-triol (PubChem CID 24928479) has the molecular formula C20H18ClN3O3 and a molecular weight of 383.84 g/mol. Its IUPAC name is 2-[[2-(4-chlorophenyl)-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl]methyl]benzene-1,3,5-triol.
| Compound Name | 2-[[2-(4-chlorophenyl)-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl]methyl]benzene-1,3,5-triol |
|---|---|
| PubChem CID | 24928479 |
| Molecular Formula | C20H18ClN3O3 |
| Molecular Weight | 383.84 g/mol |
| Exact Mass | 383.10 |
| IUPAC Name | 2-[[2-(4-chlorophenyl)-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl]methyl]benzene-1,3,5-triol |
| SMILES | Oc1cc(O)c(CN2CCc3nc(-c4ccc(Cl)cc4)ncc3C2)c(O)c1 |
| InChI | InChI=1S/C20H18ClN3O3/c21-14-3-1-12(2-4-14)20-22-9-13-10-24(6-5-17(13)23-20)11-16-18(26)7-15(25)8-19(16)27/h1-4,7-9,25-27H,5-6,10-11H2 |
| InChIKey | FCDCLGRTDDIHBK-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 89.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.84 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|