C22H19ClN6 — CID 24911419
6-[(2-chloro-7-methylquinolin-3-yl)methyl]-2-pyrimidin-5-yl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine (PubChem CID 24911419) has the molecular formula C22H19ClN6 and a molecular weight of 402.89 g/mol. Its IUPAC name is 6-[(2-chloro-7-methylquinolin-3-yl)methyl]-2-pyrimidin-5-yl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine.
| Compound Name | 6-[(2-chloro-7-methylquinolin-3-yl)methyl]-2-pyrimidin-5-yl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine |
|---|---|
| PubChem CID | 24911419 |
| Molecular Formula | C22H19ClN6 |
| Molecular Weight | 402.89 g/mol |
| Exact Mass | 402.14 |
| IUPAC Name | 6-[(2-chloro-7-methylquinolin-3-yl)methyl]-2-pyrimidin-5-yl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine |
| SMILES | Cc1ccc2cc(CN3CCc4nc(-c5cncnc5)ncc4C3)c(Cl)nc2c1 |
| InChI | InChI=1S/C22H19ClN6/c1-14-2-3-15-7-16(21(23)27-20(15)6-14)11-29-5-4-19-18(12-29)10-26-22(28-19)17-8-24-13-25-9-17/h2-3,6-10,13H,4-5,11-12H2,1H3 |
| InChIKey | BHBNTGFHTJJENY-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 67.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.89 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|