C19H19ClN4O2S — CID 24911858
6-[(2-chloro-6-methylquinolin-3-yl)methyl]-2-methylsulfonyl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine (PubChem CID 24911858) has the molecular formula C19H19ClN4O2S and a molecular weight of 402.91 g/mol. Its IUPAC name is 6-[(2-chloro-6-methylquinolin-3-yl)methyl]-2-methylsulfonyl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine.
| Compound Name | 6-[(2-chloro-6-methylquinolin-3-yl)methyl]-2-methylsulfonyl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine |
|---|---|
| PubChem CID | 24911858 |
| Molecular Formula | C19H19ClN4O2S |
| Molecular Weight | 402.91 g/mol |
| Exact Mass | 402.09 |
| IUPAC Name | 6-[(2-chloro-6-methylquinolin-3-yl)methyl]-2-methylsulfonyl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine |
| SMILES | Cc1ccc2nc(Cl)c(CN3CCc4nc(S(C)(=O)=O)ncc4C3)cc2c1 |
| InChI | InChI=1S/C19H19ClN4O2S/c1-12-3-4-16-13(7-12)8-14(18(20)22-16)10-24-6-5-17-15(11-24)9-21-19(23-17)27(2,25)26/h3-4,7-9H,5-6,10-11H2,1-2H3 |
| InChIKey | MPBCOGZTVDNOII-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 76.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.91 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|