C25H26F3N5O2 — CID 135943195
2,2-dimethyl-N-[3-[[4-oxo-2-[4-(trifluoromethyl)phenyl]-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-6-yl]methyl]-2-pyridinyl]propanamide (PubChem CID 135943195) has the molecular formula C25H26F3N5O2 and a molecular weight of 485.51 g/mol. Its IUPAC name is 2,2-dimethyl-N-[3-[[4-oxo-2-[4-(trifluoromethyl)phenyl]-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-6-yl]methyl]-2-pyridinyl]propanamide.
| Compound Name | 2,2-dimethyl-N-[3-[[4-oxo-2-[4-(trifluoromethyl)phenyl]-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-6-yl]methyl]-2-pyridinyl]propanamide |
|---|---|
| PubChem CID | 135943195 |
| Molecular Formula | C25H26F3N5O2 |
| Molecular Weight | 485.51 g/mol |
| Exact Mass | 485.20 |
| IUPAC Name | 2,2-dimethyl-N-[3-[[4-oxo-2-[4-(trifluoromethyl)phenyl]-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-6-yl]methyl]-2-pyridinyl]propanamide |
| SMILES | CC(C)(C)C(=O)Nc1ncccc1CN1CCc2nc(-c3ccc(C(F)(F)F)cc3)[nH]c(=O)c2C1 |
| InChI | InChI=1S/C25H26F3N5O2/c1-24(2,3)23(35)32-20-16(5-4-11-29-20)13-33-12-10-19-18(14-33)22(34)31-21(30-19)15-6-8-17(9-7-15)25(26,27)28/h4-9,11H,10,12-14H2,1-3H3,(H,29,32,35)(H,30,31,34) |
| InChIKey | NWMFUNZQYIVLPH-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.51 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |