C22H22FN5OS — CID 135943984
6-[[4-(4-fluorophenyl)-1,3-thiazol-2-yl]methyl]-2-(2,3,4,5-tetrahydropyridin-6-yl)-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one (PubChem CID 135943984) has the molecular formula C22H22FN5OS and a molecular weight of 423.52 g/mol. Its IUPAC name is 6-[[4-(4-fluorophenyl)-1,3-thiazol-2-yl]methyl]-2-(2,3,4,5-tetrahydropyridin-6-yl)-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one.
| Compound Name | 6-[[4-(4-fluorophenyl)-1,3-thiazol-2-yl]methyl]-2-(2,3,4,5-tetrahydropyridin-6-yl)-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 135943984 |
| Molecular Formula | C22H22FN5OS |
| Molecular Weight | 423.52 g/mol |
| Exact Mass | 423.15 |
| IUPAC Name | 6-[[4-(4-fluorophenyl)-1,3-thiazol-2-yl]methyl]-2-(2,3,4,5-tetrahydropyridin-6-yl)-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
| SMILES | O=c1[nH]c(C2=NCCCC2)nc2c1CN(Cc1nc(-c3ccc(F)cc3)cs1)CC2 |
| InChI | InChI=1S/C22H22FN5OS/c23-15-6-4-14(5-7-15)19-13-30-20(25-19)12-28-10-8-17-16(11-28)22(29)27-21(26-17)18-3-1-2-9-24-18/h4-7,13H,1-3,8-12H2,(H,26,27,29) |
| InChIKey | UNNOQWMTTNTRLK-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 74.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.52 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |