C23H17FN4O5 — CID 135944503
6-[(6-fluoro-8-nitro-4-oxochromen-3-yl)methyl]-2-phenyl-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one (PubChem CID 135944503) has the molecular formula C23H17FN4O5 and a molecular weight of 448.41 g/mol. Its IUPAC name is 6-[(6-fluoro-8-nitro-4-oxochromen-3-yl)methyl]-2-phenyl-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one.
| Compound Name | 6-[(6-fluoro-8-nitro-4-oxochromen-3-yl)methyl]-2-phenyl-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 135944503 |
| Molecular Formula | C23H17FN4O5 |
| Molecular Weight | 448.41 g/mol |
| Exact Mass | 448.12 |
| IUPAC Name | 6-[(6-fluoro-8-nitro-4-oxochromen-3-yl)methyl]-2-phenyl-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
| SMILES | O=c1[nH]c(-c2ccccc2)nc2c1CN(Cc1coc3c([N+](=O)[O-])cc(F)cc3c1=O)CC2 |
| InChI | InChI=1S/C23H17FN4O5/c24-15-8-16-20(29)14(12-33-21(16)19(9-15)28(31)32)10-27-7-6-18-17(11-27)23(30)26-22(25-18)13-4-2-1-3-5-13/h1-5,8-9,12H,6-7,10-11H2,(H,25,26,30) |
| InChIKey | RPQSWEXNDHMWKL-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 122.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.41 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|