C18H21N5O — CID 135945112
4-[(2-cyclopropyl-4-oxo-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-6-yl)methyl]-1,5-dimethylpyrrole-2-carbonitrile (PubChem CID 135945112) has the molecular formula C18H21N5O and a molecular weight of 323.40 g/mol. Its IUPAC name is 4-[(2-cyclopropyl-4-oxo-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-6-yl)methyl]-1,5-dimethylpyrrole-2-carbonitrile.
| Compound Name | 4-[(2-cyclopropyl-4-oxo-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-6-yl)methyl]-1,5-dimethylpyrrole-2-carbonitrile |
|---|---|
| PubChem CID | 135945112 |
| Molecular Formula | C18H21N5O |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.17 |
| IUPAC Name | 4-[(2-cyclopropyl-4-oxo-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-6-yl)methyl]-1,5-dimethylpyrrole-2-carbonitrile |
| SMILES | Cc1c(CN2CCc3nc(C4CC4)[nH]c(=O)c3C2)cc(C#N)n1C |
| InChI | InChI=1S/C18H21N5O/c1-11-13(7-14(8-19)22(11)2)9-23-6-5-16-15(10-23)18(24)21-17(20-16)12-3-4-12/h7,12H,3-6,9-10H2,1-2H3,(H,20,21,24) |
| InChIKey | ARQDGMLUAKSCCO-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 77.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |