C21H27N5O — CID 135945115
4-[(2-cyclohexyl-4-oxo-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-6-yl)methyl]-1,5-dimethylpyrrole-2-carbonitrile (PubChem CID 135945115) has the molecular formula C21H27N5O and a molecular weight of 365.48 g/mol. Its IUPAC name is 4-[(2-cyclohexyl-4-oxo-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-6-yl)methyl]-1,5-dimethylpyrrole-2-carbonitrile.
| Compound Name | 4-[(2-cyclohexyl-4-oxo-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-6-yl)methyl]-1,5-dimethylpyrrole-2-carbonitrile |
|---|---|
| PubChem CID | 135945115 |
| Molecular Formula | C21H27N5O |
| Molecular Weight | 365.48 g/mol |
| Exact Mass | 365.22 |
| IUPAC Name | 4-[(2-cyclohexyl-4-oxo-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-6-yl)methyl]-1,5-dimethylpyrrole-2-carbonitrile |
| SMILES | Cc1c(CN2CCc3nc(C4CCCCC4)[nH]c(=O)c3C2)cc(C#N)n1C |
| InChI | InChI=1S/C21H27N5O/c1-14-16(10-17(11-22)25(14)2)12-26-9-8-19-18(13-26)21(27)24-20(23-19)15-6-4-3-5-7-15/h10,15H,3-9,12-13H2,1-2H3,(H,23,24,27) |
| InChIKey | RNDNOAKISTZAAA-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 77.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.48 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |