C21H20F3N3O3S — CID 135947062
6-[[5-(3,4-dimethoxyphenyl)thiophen-2-yl]methyl]-2-(trifluoromethyl)-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one (PubChem CID 135947062) has the molecular formula C21H20F3N3O3S and a molecular weight of 451.47 g/mol. Its IUPAC name is 6-[[5-(3,4-dimethoxyphenyl)thiophen-2-yl]methyl]-2-(trifluoromethyl)-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one.
| Compound Name | 6-[[5-(3,4-dimethoxyphenyl)thiophen-2-yl]methyl]-2-(trifluoromethyl)-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 135947062 |
| Molecular Formula | C21H20F3N3O3S |
| Molecular Weight | 451.47 g/mol |
| Exact Mass | 451.12 |
| IUPAC Name | 6-[[5-(3,4-dimethoxyphenyl)thiophen-2-yl]methyl]-2-(trifluoromethyl)-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
| SMILES | COc1ccc(-c2ccc(CN3CCc4nc(C(F)(F)F)[nH]c(=O)c4C3)s2)cc1OC |
| InChI | InChI=1S/C21H20F3N3O3S/c1-29-16-5-3-12(9-17(16)30-2)18-6-4-13(31-18)10-27-8-7-15-14(11-27)19(28)26-20(25-15)21(22,23)24/h3-6,9H,7-8,10-11H2,1-2H3,(H,25,26,28) |
| InChIKey | AMWXPJNIZFRJLN-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 67.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.47 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |