C19H19N7O — CID 135948865
N-(4-morpholin-4-ylphenyl)-5-(1H-pyrazol-4-yl)-[1,2,4]triazolo[1,5-a]pyridin-8-amine (PubChem CID 135948865) has the molecular formula C19H19N7O and a molecular weight of 361.41 g/mol. Its IUPAC name is N-(4-morpholin-4-ylphenyl)-5-(1H-pyrazol-4-yl)-[1,2,4]triazolo[1,5-a]pyridin-8-amine.
| Compound Name | N-(4-morpholin-4-ylphenyl)-5-(1H-pyrazol-4-yl)-[1,2,4]triazolo[1,5-a]pyridin-8-amine |
|---|---|
| PubChem CID | 135948865 |
| Molecular Formula | C19H19N7O |
| Molecular Weight | 361.41 g/mol |
| Exact Mass | 361.17 |
| IUPAC Name | N-(4-morpholin-4-ylphenyl)-5-(1H-pyrazol-4-yl)-[1,2,4]triazolo[1,5-a]pyridin-8-amine |
| SMILES | c1nc2c(Nc3ccc(N4CCOCC4)cc3)ccc(-c3cn[nH]c3)n2n1 |
| InChI | InChI=1S/C19H19N7O/c1-3-16(25-7-9-27-10-8-25)4-2-15(1)24-17-5-6-18(14-11-21-22-12-14)26-19(17)20-13-23-26/h1-6,11-13,24H,7-10H2,(H,21,22) |
| InChIKey | NGINLVQDJWNSLQ-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 83.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.41 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|