C20H17F2N3O2S — CID 135949060
2-[(2,3-difluorophenyl)methylsulfanyl]-4-[(2R)-2-(5-methylfuran-2-yl)propyl]-6-oxo-1H-pyrimidine-5-carbonitrile (PubChem CID 135949060) has the molecular formula C20H17F2N3O2S and a molecular weight of 401.44 g/mol. Its IUPAC name is 2-[(2,3-difluorophenyl)methylsulfanyl]-4-[(2R)-2-(5-methylfuran-2-yl)propyl]-6-oxo-1H-pyrimidine-5-carbonitrile.
| Compound Name | 2-[(2,3-difluorophenyl)methylsulfanyl]-4-[(2R)-2-(5-methylfuran-2-yl)propyl]-6-oxo-1H-pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 135949060 |
| Molecular Formula | C20H17F2N3O2S |
| Molecular Weight | 401.44 g/mol |
| Exact Mass | 401.10 |
| IUPAC Name | 2-[(2,3-difluorophenyl)methylsulfanyl]-4-[(2R)-2-(5-methylfuran-2-yl)propyl]-6-oxo-1H-pyrimidine-5-carbonitrile |
| SMILES | Cc1ccc([C@H](C)Cc2nc(SCc3cccc(F)c3F)[nH]c(=O)c2C#N)o1 |
| InChI | InChI=1S/C20H17F2N3O2S/c1-11(17-7-6-12(2)27-17)8-16-14(9-23)19(26)25-20(24-16)28-10-13-4-3-5-15(21)18(13)22/h3-7,11H,8,10H2,1-2H3,(H,24,25,26)/t11-/m1/s1 |
| InChIKey | WJBBHQAXTGHNAL-LLVKDONJSA-N |
| XLogP | 4.46 |
| TPSA | 82.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.44 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_B(27)', 'substructure': 'N/A'} |
|---|