C16H10F2N2O3S — CID 45105392
N-[(5Z)-5-[[5-(2,4-difluorophenyl)furan-2-yl]methylidene]-4-oxo-1,3-thiazol-2-yl]acetamide (PubChem CID 45105392) has the molecular formula C16H10F2N2O3S and a molecular weight of 348.33 g/mol. Its IUPAC name is N-[(5Z)-5-[[5-(2,4-difluorophenyl)furan-2-yl]methylidene]-4-oxo-1,3-thiazol-2-yl]acetamide.
| Compound Name | N-[(5Z)-5-[[5-(2,4-difluorophenyl)furan-2-yl]methylidene]-4-oxo-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 45105392 |
| Molecular Formula | C16H10F2N2O3S |
| Molecular Weight | 348.33 g/mol |
| Exact Mass | 348.04 |
| IUPAC Name | N-[(5Z)-5-[[5-(2,4-difluorophenyl)furan-2-yl]methylidene]-4-oxo-1,3-thiazol-2-yl]acetamide |
| SMILES | CC(=O)NC1=NC(=O)/C(=C/c2ccc(-c3ccc(F)cc3F)o2)S1 |
| InChI | InChI=1S/C16H10F2N2O3S/c1-8(21)19-16-20-15(22)14(24-16)7-10-3-5-13(23-10)11-4-2-9(17)6-12(11)18/h2-7H,1H3,(H,19,20,21,22)/b14-7- |
| InChIKey | MFUQWIWIAJSSOH-AUWJEWJLSA-N |
| XLogP | 3.33 |
| TPSA | 71.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.33 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|