C20H21N4O6P — CID 135949567
[4-[4-(1,3-dimethylindol-5-yl)-5-oxo-1H-1,2,4-triazol-3-yl]-2-ethyl-5-hydroxyphenyl] dihydrogen phosphate (PubChem CID 135949567) has the molecular formula C20H21N4O6P and a molecular weight of 444.38 g/mol. Its IUPAC name is [4-[4-(1,3-dimethylindol-5-yl)-5-oxo-1H-1,2,4-triazol-3-yl]-2-ethyl-5-hydroxyphenyl] dihydrogen phosphate.
| Compound Name | [4-[4-(1,3-dimethylindol-5-yl)-5-oxo-1H-1,2,4-triazol-3-yl]-2-ethyl-5-hydroxyphenyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 135949567 |
| Molecular Formula | C20H21N4O6P |
| Molecular Weight | 444.38 g/mol |
| Exact Mass | 444.12 |
| IUPAC Name | [4-[4-(1,3-dimethylindol-5-yl)-5-oxo-1H-1,2,4-triazol-3-yl]-2-ethyl-5-hydroxyphenyl] dihydrogen phosphate |
| SMILES | CCc1cc(-c2n[nH]c(=O)n2-c2ccc3c(c2)c(C)cn3C)c(O)cc1OP(=O)(O)O |
| InChI | InChI=1S/C20H21N4O6P/c1-4-12-7-15(17(25)9-18(12)30-31(27,28)29)19-21-22-20(26)24(19)13-5-6-16-14(8-13)11(2)10-23(16)3/h5-10,25H,4H2,1-3H3,(H,22,26)(H2,27,28,29) |
| InChIKey | BALPIGOECICYSD-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 142.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.38 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|