C20H20N4O6S — CID 136994974
5-[3-(2,4-dihydroxy-5-propan-2-ylphenyl)-5-oxo-1H-1,2,4-triazol-4-yl]-1-methylindole-3-sulfonic acid (PubChem CID 136994974) has the molecular formula C20H20N4O6S and a molecular weight of 444.47 g/mol. Its IUPAC name is 5-[3-(2,4-dihydroxy-5-propan-2-ylphenyl)-5-oxo-1H-1,2,4-triazol-4-yl]-1-methylindole-3-sulfonic acid.
| Compound Name | 5-[3-(2,4-dihydroxy-5-propan-2-ylphenyl)-5-oxo-1H-1,2,4-triazol-4-yl]-1-methylindole-3-sulfonic acid |
|---|---|
| PubChem CID | 136994974 |
| Molecular Formula | C20H20N4O6S |
| Molecular Weight | 444.47 g/mol |
| Exact Mass | 444.11 |
| IUPAC Name | 5-[3-(2,4-dihydroxy-5-propan-2-ylphenyl)-5-oxo-1H-1,2,4-triazol-4-yl]-1-methylindole-3-sulfonic acid |
| SMILES | CC(C)c1cc(-c2n[nH]c(=O)n2-c2ccc3c(c2)c(S(=O)(=O)O)cn3C)c(O)cc1O |
| InChI | InChI=1S/C20H20N4O6S/c1-10(2)12-7-14(17(26)8-16(12)25)19-21-22-20(27)24(19)11-4-5-15-13(6-11)18(9-23(15)3)31(28,29)30/h4-10,25-26H,1-3H3,(H,22,27)(H,28,29,30) |
| InChIKey | HQRRJEMQUGWZOV-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 150.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.47 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|